C20H28O2S — CID 57071157
(7S,8S,9S,10R,13S,14S)-10,13-dimethyl-7-methylsulfinyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 57071157) has the molecular formula C20H28O2S and a molecular weight of 332.51 g/mol. Its IUPAC name is (7S,8S,9S,10R,13S,14S)-10,13-dimethyl-7-methylsulfinyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (7S,8S,9S,10R,13S,14S)-10,13-dimethyl-7-methylsulfinyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 57071157 |
| Molecular Formula | C20H28O2S |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | (7S,8S,9S,10R,13S,14S)-10,13-dimethyl-7-methylsulfinyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CS(=O)[C@H]1CC2=CC(=O)C=C[C@]2(C)[C@H]2CC[C@]3(C)CCC[C@H]3[C@H]12 |
| InChI | InChI=1S/C20H28O2S/c1-19-8-4-5-15(19)18-16(7-9-19)20(2)10-6-14(21)11-13(20)12-17(18)23(3)22/h6,10-11,15-18H,4-5,7-9,12H2,1-3H3/t15-,16-,17-,18-,19-,20-,23?/m0/s1 |
| InChIKey | DDVOSDNZSWOFIR-ULMUJLCSSA-N |
| XLogP | 4.04 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |