C20H24O2 — CID 150215252
(8S,9S,10R,13S,14S)-10,13-dimethyl-6-methylidene-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene-3,7-dione (PubChem CID 150215252) has the molecular formula C20H24O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S)-10,13-dimethyl-6-methylidene-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene-3,7-dione.
| Compound Name | (8S,9S,10R,13S,14S)-10,13-dimethyl-6-methylidene-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene-3,7-dione |
|---|---|
| PubChem CID | 150215252 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | (8S,9S,10R,13S,14S)-10,13-dimethyl-6-methylidene-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene-3,7-dione |
| SMILES | C=C1C(=O)[C@H]2[C@@H]3CCC[C@@]3(C)CC[C@@H]2[C@@]2(C)C=CC(=O)C=C12 |
| InChI | InChI=1S/C20H24O2/c1-12-16-11-13(21)6-10-20(16,3)15-7-9-19(2)8-4-5-14(19)17(15)18(12)22/h6,10-11,14-15,17H,1,4-5,7-9H2,2-3H3/t14-,15-,17-,19-,20+/m0/s1 |
| InChIKey | FSILFAXSMFKVGF-NHQOTNMQSA-N |
| XLogP | 4.03 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|