C21H24O5 — CID 70926703
(8R,9S,10R,13S,14S,17R)-17-acetyl-17-hydroxy-10,13-dimethyl-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthrene-3,6,7-trione (PubChem CID 70926703) has the molecular formula C21H24O5 and a molecular weight of 356.42 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S,17R)-17-acetyl-17-hydroxy-10,13-dimethyl-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthrene-3,6,7-trione.
| Compound Name | (8R,9S,10R,13S,14S,17R)-17-acetyl-17-hydroxy-10,13-dimethyl-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthrene-3,6,7-trione |
|---|---|
| PubChem CID | 70926703 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | (8R,9S,10R,13S,14S,17R)-17-acetyl-17-hydroxy-10,13-dimethyl-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthrene-3,6,7-trione |
| SMILES | CC(=O)[C@@]1(O)CC[C@H]2[C@@H]3C(=O)C(=O)C4=CC(=O)C=C[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C21H24O5/c1-11(22)21(26)9-6-14-16-13(5-8-20(14,21)3)19(2)7-4-12(23)10-15(19)17(24)18(16)25/h4,7,10,13-14,16,26H,5-6,8-9H2,1-3H3/t13-,14-,16+,19+,20-,21-/m0/s1 |
| InChIKey | MCJQNLXQCRPIDK-BUPXVUBVSA-N |
| XLogP | 1.97 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|