C21H28O5 — CID 70926281
(7S,8R,9S,10R,13S,14S,17R)-17-acetyl-7,17-dihydroxy-10,13-dimethyl-4,5,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,6-dione (PubChem CID 70926281) has the molecular formula C21H28O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is (7S,8R,9S,10R,13S,14S,17R)-17-acetyl-7,17-dihydroxy-10,13-dimethyl-4,5,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,6-dione.
| Compound Name | (7S,8R,9S,10R,13S,14S,17R)-17-acetyl-7,17-dihydroxy-10,13-dimethyl-4,5,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,6-dione |
|---|---|
| PubChem CID | 70926281 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | (7S,8R,9S,10R,13S,14S,17R)-17-acetyl-7,17-dihydroxy-10,13-dimethyl-4,5,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,6-dione |
| SMILES | CC(=O)[C@@]1(O)CC[C@H]2[C@@H]3[C@H](O)C(=O)C4CC(=O)C=C[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C21H28O5/c1-11(22)21(26)9-6-14-16-13(5-8-20(14,21)3)19(2)7-4-12(23)10-15(19)17(24)18(16)25/h4,7,13-16,18,25-26H,5-6,8-10H2,1-3H3/t13-,14-,15?,16+,18-,19+,20-,21-/m0/s1 |
| InChIKey | HYISVWACUWSVGU-RZBUQLHESA-N |
| XLogP | 1.84 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |