C21H26O4 — CID 70926614
(8R,9S,10R,13S,14S,17R)-17-acetyl-3,17-dihydroxy-10,13-dimethyl-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-7-one (PubChem CID 70926614) has the molecular formula C21H26O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S,17R)-17-acetyl-3,17-dihydroxy-10,13-dimethyl-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-7-one.
| Compound Name | (8R,9S,10R,13S,14S,17R)-17-acetyl-3,17-dihydroxy-10,13-dimethyl-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-7-one |
|---|---|
| PubChem CID | 70926614 |
| Molecular Formula | C21H26O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | (8R,9S,10R,13S,14S,17R)-17-acetyl-3,17-dihydroxy-10,13-dimethyl-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-7-one |
| SMILES | CC(=O)[C@@]1(O)CC[C@H]2[C@@H]3C(=O)C=C4C=C(O)C=C[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C21H26O4/c1-12(22)21(25)9-6-16-18-15(5-8-20(16,21)3)19(2)7-4-14(23)10-13(19)11-17(18)24/h4,7,10-11,15-16,18,23,25H,5-6,8-9H2,1-3H3/t15-,16-,18+,19-,20-,21-/m0/s1 |
| InChIKey | CFHYRGYQECSPOC-JSQCKWNTSA-N |
| XLogP | 3.28 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |