C9H9N3O3 — CID 57072103
1-(furan-2-yl)-3-(5-oxo-1,2-dihydropyrrol-3-yl)urea (PubChem CID 57072103) has the molecular formula C9H9N3O3 and a molecular weight of 207.19 g/mol. Its IUPAC name is 1-(furan-2-yl)-3-(5-oxo-1,2-dihydropyrrol-3-yl)urea.
| Compound Name | 1-(furan-2-yl)-3-(5-oxo-1,2-dihydropyrrol-3-yl)urea |
|---|---|
| PubChem CID | 57072103 |
| Molecular Formula | C9H9N3O3 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 1-(furan-2-yl)-3-(5-oxo-1,2-dihydropyrrol-3-yl)urea |
| SMILES | O=C1C=C(NC(=O)Nc2ccco2)CN1 |
| InChI | InChI=1S/C9H9N3O3/c13-7-4-6(5-10-7)11-9(14)12-8-2-1-3-15-8/h1-4H,5H2,(H,10,13)(H2,11,12,14) |
| InChIKey | ZAYDOJPNOQCPEJ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |