C25H32N2O3 — CID 57073280
(3aS,3bS,9aS,9bR,11aS)-N-(2-hydroxyphenyl)-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinoline-8-carboxamide (PubChem CID 57073280) has the molecular formula C25H32N2O3 and a molecular weight of 408.54 g/mol. Its IUPAC name is (3aS,3bS,9aS,9bR,11aS)-N-(2-hydroxyphenyl)-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinoline-8-carboxamide.
| Compound Name | (3aS,3bS,9aS,9bR,11aS)-N-(2-hydroxyphenyl)-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 57073280 |
| Molecular Formula | C25H32N2O3 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | (3aS,3bS,9aS,9bR,11aS)-N-(2-hydroxyphenyl)-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinoline-8-carboxamide |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CCC3NC(=O)C(C(=O)Nc4ccccc4O)=C[C@]3(C)[C@@H]1CC2 |
| InChI | InChI=1S/C25H32N2O3/c1-24-12-5-6-17(24)15-9-10-21-25(2,18(15)11-13-24)14-16(23(30)27-21)22(29)26-19-7-3-4-8-20(19)28/h3-4,7-8,14-15,17-18,21,28H,5-6,9-13H2,1-2H3,(H,26,29)(H,27,30)/t15-,17-,18+,21?,24-,25+/m0/s1 |
| InChIKey | BDJKXOTVDGZGGZ-JVWDVLSLSA-N |
| XLogP | 4.39 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|