C28H39NO — CID 70257333
(3aS,3bS,5aR,9aS,9bS,11aS)-8-(4-tert-butylphenyl)-9a,11a-dimethyl-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinolin-7-one (PubChem CID 70257333) has the molecular formula C28H39NO and a molecular weight of 405.63 g/mol. Its IUPAC name is (3aS,3bS,5aR,9aS,9bS,11aS)-8-(4-tert-butylphenyl)-9a,11a-dimethyl-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinolin-7-one.
| Compound Name | (3aS,3bS,5aR,9aS,9bS,11aS)-8-(4-tert-butylphenyl)-9a,11a-dimethyl-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinolin-7-one |
|---|---|
| PubChem CID | 70257333 |
| Molecular Formula | C28H39NO |
| Molecular Weight | 405.63 g/mol |
| Exact Mass | 405.30 |
| IUPAC Name | (3aS,3bS,5aR,9aS,9bS,11aS)-8-(4-tert-butylphenyl)-9a,11a-dimethyl-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinolin-7-one |
| SMILES | CC(C)(C)c1ccc(C2=C[C@@]3(C)[C@@H](CC[C@H]4[C@@H]5CCC[C@@]5(C)CC[C@@H]43)NC2=O)cc1 |
| InChI | InChI=1S/C28H39NO/c1-26(2,3)19-10-8-18(9-11-19)21-17-28(5)23-14-16-27(4)15-6-7-22(27)20(23)12-13-24(28)29-25(21)30/h8-11,17,20,22-24H,6-7,12-16H2,1-5H3,(H,29,30)/t20-,22-,23-,24+,27-,28+/m0/s1 |
| InChIKey | YFGSQYYIRYKDNI-SQDDDLEWSA-N |
| XLogP | 6.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.63 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |