C34H42N2O4 — CID 57201034
(3aS,3bS,9aS,9bR,11aS)-N-[bis(4-methoxyphenyl)methyl]-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinoline-8-carboxamide (PubChem CID 57201034) has the molecular formula C34H42N2O4 and a molecular weight of 542.72 g/mol. Its IUPAC name is (3aS,3bS,9aS,9bR,11aS)-N-[bis(4-methoxyphenyl)methyl]-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinoline-8-carboxamide.
| Compound Name | (3aS,3bS,9aS,9bR,11aS)-N-[bis(4-methoxyphenyl)methyl]-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 57201034 |
| Molecular Formula | C34H42N2O4 |
| Molecular Weight | 542.72 g/mol |
| Exact Mass | 542.31 |
| IUPAC Name | (3aS,3bS,9aS,9bR,11aS)-N-[bis(4-methoxyphenyl)methyl]-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinoline-8-carboxamide |
| SMILES | COc1ccc(C(NC(=O)C2=C[C@@]3(C)C(CC[C@@H]4[C@H]3CC[C@]3(C)CCC[C@@H]43)NC2=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C34H42N2O4/c1-33-18-5-6-27(33)25-15-16-29-34(2,28(25)17-19-33)20-26(31(37)35-29)32(38)36-30(21-7-11-23(39-3)12-8-21)22-9-13-24(40-4)14-10-22/h7-14,20,25,27-30H,5-6,15-19H2,1-4H3,(H,35,37)(H,36,38)/t25-,27-,28+,29?,33-,34+/m0/s1 |
| InChIKey | CUHLCQCBGAEGHO-CMBGVTRISA-N |
| XLogP | 5.97 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.72 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|