C27H36N2O3 — CID 67481088
(1R,2S,10S,11S,15S)-2,15-dimethyl-6-azapentacyclo[8.7.0.02,7.04,14.011,15]heptadec-3-en-5-one;2-(4-methoxyphenyl)acetamide (PubChem CID 67481088) has the molecular formula C27H36N2O3 and a molecular weight of 436.60 g/mol. Its IUPAC name is (1R,2S,10S,11S,15S)-2,15-dimethyl-6-azapentacyclo[8.7.0.02,7.04,14.011,15]heptadec-3-en-5-one;2-(4-methoxyphenyl)acetamide.
| Compound Name | (1R,2S,10S,11S,15S)-2,15-dimethyl-6-azapentacyclo[8.7.0.02,7.04,14.011,15]heptadec-3-en-5-one;2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 67481088 |
| Molecular Formula | C27H36N2O3 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.27 |
| IUPAC Name | (1R,2S,10S,11S,15S)-2,15-dimethyl-6-azapentacyclo[8.7.0.02,7.04,14.011,15]heptadec-3-en-5-one;2-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(N)=O)cc1.C[C@]12C=C3C(=O)NC1CC[C@@H]1[C@H]2CC[C@]2(C)C3CC[C@@H]12 |
| InChI | InChI=1S/C18H25NO.C9H11NO2/c1-17-8-7-14-10-3-6-15-18(14,2)9-11(16(20)19-15)13(17)5-4-12(10)17;1-12-8-4-2-7(3-5-8)6-9(10)11/h9-10,12-15H,3-8H2,1-2H3,(H,19,20);2-5H,6H2,1H3,(H2,10,11)/t10-,12-,13?,14+,15?,17-,18+;/m0./s1 |
| InChIKey | APMMXUHBGGUFLA-XPFXCMBWSA-N |
| XLogP | 4.01 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |