C22H32O — CID 70571866
(5S,8S,9S,10S,13S,14S)-10,13-dimethyl-2-prop-2-enyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 70571866) has the molecular formula C22H32O and a molecular weight of 312.50 g/mol. Its IUPAC name is (5S,8S,9S,10S,13S,14S)-10,13-dimethyl-2-prop-2-enyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (5S,8S,9S,10S,13S,14S)-10,13-dimethyl-2-prop-2-enyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 70571866 |
| Molecular Formula | C22H32O |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | (5S,8S,9S,10S,13S,14S)-10,13-dimethyl-2-prop-2-enyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C=CCC1=C[C@@]2(C)[C@@H](CC[C@H]3[C@@H]4CCC[C@@]4(C)CC[C@@H]32)CC1=O |
| InChI | InChI=1S/C22H32O/c1-4-6-15-14-22(3)16(13-20(15)23)8-9-17-18-7-5-11-21(18,2)12-10-19(17)22/h4,14,16-19H,1,5-13H2,2-3H3/t16-,17-,18-,19-,21-,22-/m0/s1 |
| InChIKey | FFKUAEWQNNWMNT-BLQWBTBKSA-N |
| XLogP | 5.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|