C19H28O2 — CID 45043806
(3R,5R,8S)-2,16-dimethyl-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadecan-6-one (PubChem CID 45043806) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is (3R,5R,8S)-2,16-dimethyl-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadecan-6-one.
| Compound Name | (3R,5R,8S)-2,16-dimethyl-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadecan-6-one |
|---|---|
| PubChem CID | 45043806 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | (3R,5R,8S)-2,16-dimethyl-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadecan-6-one |
| SMILES | CC12CCCC1C1CC[C@H]3CC(=O)[C@@H]4O[C@@H]4C3(C)C1CC2 |
| InChI | InChI=1S/C19H28O2/c1-18-8-3-4-13(18)12-6-5-11-10-15(20)16-17(21-16)19(11,2)14(12)7-9-18/h11-14,16-17H,3-10H2,1-2H3/t11-,12?,13?,14?,16-,17-,18?,19?/m0/s1 |
| InChIKey | AELKZYLQKXEYRL-IFISHNLOSA-N |
| XLogP | 3.98 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|