C27H39FO2 — CID 86735381
(1S,2S,11S,12S,15R,16S)-15-(6-fluoro-6-methylhepta-2,4-dien-2-yl)-2,16-dimethyl-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadecan-6-one (PubChem CID 86735381) has the molecular formula C27H39FO2 and a molecular weight of 414.61 g/mol. Its IUPAC name is (1S,2S,11S,12S,15R,16S)-15-(6-fluoro-6-methylhepta-2,4-dien-2-yl)-2,16-dimethyl-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadecan-6-one.
| Compound Name | (1S,2S,11S,12S,15R,16S)-15-(6-fluoro-6-methylhepta-2,4-dien-2-yl)-2,16-dimethyl-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadecan-6-one |
|---|---|
| PubChem CID | 86735381 |
| Molecular Formula | C27H39FO2 |
| Molecular Weight | 414.61 g/mol |
| Exact Mass | 414.29 |
| IUPAC Name | (1S,2S,11S,12S,15R,16S)-15-(6-fluoro-6-methylhepta-2,4-dien-2-yl)-2,16-dimethyl-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadecan-6-one |
| SMILES | CC(=CC=CC(C)(C)F)[C@H]1CC[C@H]2[C@@H]3CCC4CC(=O)C5OC5[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H39FO2/c1-16(7-6-13-25(2,3)28)19-10-11-20-18-9-8-17-15-22(29)23-24(30-23)27(17,5)21(18)12-14-26(19,20)4/h6-7,13,17-21,23-24H,8-12,14-15H2,1-5H3/t17?,18-,19+,20-,21-,23?,24?,26+,27-/m0/s1 |
| InChIKey | XNAFIVBWYBLFHS-TYZUHUGSSA-N |
| XLogP | 6.45 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.61 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|