C21H32O3 — CID 87553445
(1S,2R,11S,12S,15S,16S)-15-hydroxy-2,7,7,16-tetramethyl-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadecan-6-one (PubChem CID 87553445) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is (1S,2R,11S,12S,15S,16S)-15-hydroxy-2,7,7,16-tetramethyl-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadecan-6-one.
| Compound Name | (1S,2R,11S,12S,15S,16S)-15-hydroxy-2,7,7,16-tetramethyl-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadecan-6-one |
|---|---|
| PubChem CID | 87553445 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | (1S,2R,11S,12S,15S,16S)-15-hydroxy-2,7,7,16-tetramethyl-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadecan-6-one |
| SMILES | CC1(C)C(=O)C2OC2[C@@]2(C)C1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)CC[C@@H]12 |
| InChI | InChI=1S/C21H32O3/c1-19(2)14-7-5-11-12-6-8-15(22)20(12,3)10-9-13(11)21(14,4)18-16(24-18)17(19)23/h11-16,18,22H,5-10H2,1-4H3/t11-,12-,13-,14?,15-,16?,18?,20-,21+/m0/s1 |
| InChIKey | LSKVKEOGRGDATI-JMIFCXIUSA-N |
| XLogP | 3.58 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|