C19H28O3 — CID 22793101
(1S,2S,11S,12S,15S,16S)-15-hydroxy-2,16-dimethyl-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadecan-6-one (PubChem CID 22793101) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is (1S,2S,11S,12S,15S,16S)-15-hydroxy-2,16-dimethyl-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadecan-6-one.
| Compound Name | (1S,2S,11S,12S,15S,16S)-15-hydroxy-2,16-dimethyl-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadecan-6-one |
|---|---|
| PubChem CID | 22793101 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (1S,2S,11S,12S,15S,16S)-15-hydroxy-2,16-dimethyl-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadecan-6-one |
| SMILES | C[C@]12C(CC[C@@H]3[C@@H]1CC[C@]1(C)[C@@H](O)CC[C@@H]31)CC(=O)C1OC12 |
| InChI | InChI=1S/C19H28O3/c1-18-8-7-13-11(12(18)5-6-15(18)21)4-3-10-9-14(20)16-17(22-16)19(10,13)2/h10-13,15-17,21H,3-9H2,1-2H3/t10?,11-,12-,13-,15-,16?,17?,18-,19-/m0/s1 |
| InChIKey | XRMDTNFORYAJOL-NAZRZWLVSA-N |
| XLogP | 2.95 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|