C27H35NO3 — CID 102139143
(1S,2S,3S,7R,10S,13S,14S,17S,18S)-17-hydroxy-2,18-dimethyl-6-(3-methylphenyl)-4-oxa-5-azapentacyclo[11.7.0.02,10.03,7.014,18]icos-5-en-8-one (PubChem CID 102139143) has the molecular formula C27H35NO3 and a molecular weight of 421.58 g/mol. Its IUPAC name is (1S,2S,3S,7R,10S,13S,14S,17S,18S)-17-hydroxy-2,18-dimethyl-6-(3-methylphenyl)-4-oxa-5-azapentacyclo[11.7.0.02,10.03,7.014,18]icos-5-en-8-one.
| Compound Name | (1S,2S,3S,7R,10S,13S,14S,17S,18S)-17-hydroxy-2,18-dimethyl-6-(3-methylphenyl)-4-oxa-5-azapentacyclo[11.7.0.02,10.03,7.014,18]icos-5-en-8-one |
|---|---|
| PubChem CID | 102139143 |
| Molecular Formula | C27H35NO3 |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | (1S,2S,3S,7R,10S,13S,14S,17S,18S)-17-hydroxy-2,18-dimethyl-6-(3-methylphenyl)-4-oxa-5-azapentacyclo[11.7.0.02,10.03,7.014,18]icos-5-en-8-one |
| SMILES | Cc1cccc(C2=NO[C@H]3[C@@H]2C(=O)C[C@@H]2CC[C@H]4[C@@H]5CC[C@H](O)[C@@]5(C)CC[C@@H]4[C@]23C)c1 |
| InChI | InChI=1S/C27H35NO3/c1-15-5-4-6-16(13-15)24-23-21(29)14-17-7-8-18-19-9-10-22(30)26(19,2)12-11-20(18)27(17,3)25(23)31-28-24/h4-6,13,17-20,22-23,25,30H,7-12,14H2,1-3H3/t17-,18-,19-,20-,22-,23+,25-,26-,27-/m0/s1 |
| InChIKey | JTZXNRGRQFYXSH-KTXRGGHQSA-N |
| XLogP | 4.91 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |