C24H37NO2 — CID 139069804
methanol;(1R,2R,5R,6R,9R,10S,13R,21S)-1,5,21-trimethyl-16-azapentacyclo[11.8.0.02,10.05,9.015,20]henicosa-15(20),16,18-trien-6-ol (PubChem CID 139069804) has the molecular formula C24H37NO2 and a molecular weight of 371.57 g/mol. Its IUPAC name is methanol;(1R,2R,5R,6R,9R,10S,13R,21S)-1,5,21-trimethyl-16-azapentacyclo[11.8.0.02,10.05,9.015,20]henicosa-15(20),16,18-trien-6-ol.
| Compound Name | methanol;(1R,2R,5R,6R,9R,10S,13R,21S)-1,5,21-trimethyl-16-azapentacyclo[11.8.0.02,10.05,9.015,20]henicosa-15(20),16,18-trien-6-ol |
|---|---|
| PubChem CID | 139069804 |
| Molecular Formula | C24H37NO2 |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.28 |
| IUPAC Name | methanol;(1R,2R,5R,6R,9R,10S,13R,21S)-1,5,21-trimethyl-16-azapentacyclo[11.8.0.02,10.05,9.015,20]henicosa-15(20),16,18-trien-6-ol |
| SMILES | CO.C[C@@H]1c2cccnc2C[C@H]2CC[C@@H]3[C@H]4CC[C@@H](O)[C@]4(C)CC[C@H]3[C@@]21C |
| InChI | InChI=1S/C23H33NO.CH4O/c1-14-16-5-4-12-24-20(16)13-15-6-7-17-18-8-9-21(25)22(18,2)11-10-19(17)23(14,15)3;1-2/h4-5,12,14-15,17-19,21,25H,6-11,13H2,1-3H3;2H,1H3/t14-,15-,17-,18-,19-,21-,22-,23-;/m1./s1 |
| InChIKey | VOHNOLCSXULOQF-JQSGQHQISA-N |
| XLogP | 4.57 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |