C24H36O5 — CID 57269250
[3-[(8S,9R,10S,13S,14S)-1-hydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-2-yl]-3-oxopropyl] acetate (PubChem CID 57269250) has the molecular formula C24H36O5 and a molecular weight of 404.55 g/mol. Its IUPAC name is [3-[(8S,9R,10S,13S,14S)-1-hydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-2-yl]-3-oxopropyl] acetate.
| Compound Name | [3-[(8S,9R,10S,13S,14S)-1-hydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-2-yl]-3-oxopropyl] acetate |
|---|---|
| PubChem CID | 57269250 |
| Molecular Formula | C24H36O5 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | [3-[(8S,9R,10S,13S,14S)-1-hydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-2-yl]-3-oxopropyl] acetate |
| SMILES | CC(=O)OCCC(=O)C1C(=O)CC2CC[C@@H]3[C@@H](CC[C@]4(C)CCC[C@@H]34)[C@@]2(C)C1O |
| InChI | InChI=1S/C24H36O5/c1-14(25)29-12-9-19(26)21-20(27)13-15-6-7-16-17-5-4-10-23(17,2)11-8-18(16)24(15,3)22(21)28/h15-18,21-22,28H,4-13H2,1-3H3/t15?,16-,17-,18+,21?,22?,23-,24-/m0/s1 |
| InChIKey | GAGRYWXCMHJCHG-COFHVWAASA-N |
| XLogP | 3.71 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|