C13H18O6 — CID 57074873
[(3aR,4R,5R,6aS)-4-[(4R)-2-methyl-1,3-dioxolan-4-yl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] acetate (PubChem CID 57074873) has the molecular formula C13H18O6 and a molecular weight of 270.28 g/mol. Its IUPAC name is [(3aR,4R,5R,6aS)-4-[(4R)-2-methyl-1,3-dioxolan-4-yl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] acetate.
| Compound Name | [(3aR,4R,5R,6aS)-4-[(4R)-2-methyl-1,3-dioxolan-4-yl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] acetate |
|---|---|
| PubChem CID | 57074873 |
| Molecular Formula | C13H18O6 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | [(3aR,4R,5R,6aS)-4-[(4R)-2-methyl-1,3-dioxolan-4-yl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@H]2OC(=O)C[C@@H]2[C@H]1[C@@H]1COC(C)O1 |
| InChI | InChI=1S/C13H18O6/c1-6(14)17-10-4-9-8(3-12(15)19-9)13(10)11-5-16-7(2)18-11/h7-11,13H,3-5H2,1-2H3/t7?,8-,9-,10+,11-,13+/m0/s1 |
| InChIKey | JKESHTJTSJMXHT-WCBWJVDFSA-N |
| XLogP | 0.63 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |