C9H13N3O4S — CID 57075098
2-[4-(1-carboxy-2-sulfanylethyl)triazol-1-yl]butanoic acid (PubChem CID 57075098) has the molecular formula C9H13N3O4S and a molecular weight of 259.29 g/mol. Its IUPAC name is 2-[4-(1-carboxy-2-sulfanylethyl)triazol-1-yl]butanoic acid.
| Compound Name | 2-[4-(1-carboxy-2-sulfanylethyl)triazol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 57075098 |
| Molecular Formula | C9H13N3O4S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 2-[4-(1-carboxy-2-sulfanylethyl)triazol-1-yl]butanoic acid |
| SMILES | CCC(C(=O)O)n1cc(C(CS)C(=O)O)nn1 |
| InChI | InChI=1S/C9H13N3O4S/c1-2-7(9(15)16)12-3-6(10-11-12)5(4-17)8(13)14/h3,5,7,17H,2,4H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | DNQCVYXZSYLGES-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|