C16H30ClNOSi — CID 57077507
tert-butyl-[[(2R,3S)-2-(2-chloroethenyl)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-dimethylsilane (PubChem CID 57077507) has the molecular formula C16H30ClNOSi and a molecular weight of 315.96 g/mol. Its IUPAC name is tert-butyl-[[(2R,3S)-2-(2-chloroethenyl)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(2R,3S)-2-(2-chloroethenyl)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 57077507 |
| Molecular Formula | C16H30ClNOSi |
| Molecular Weight | 315.96 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | tert-butyl-[[(2R,3S)-2-(2-chloroethenyl)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-dimethylsilane |
| SMILES | CN1C2CCC1[C@@H](C=CCl)[C@@H](O[Si](C)(C)C(C)(C)C)C2 |
| InChI | InChI=1S/C16H30ClNOSi/c1-16(2,3)20(5,6)19-15-11-12-7-8-14(18(12)4)13(15)9-10-17/h9-10,12-15H,7-8,11H2,1-6H3/t12?,13-,14?,15+/m1/s1 |
| InChIKey | SPMHASSGKMVXPK-JYVUQVBGSA-N |
| XLogP | 4.61 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.96 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|