C18H17ClF3NO3 — CID 57077928
2-amino-3-(2-chlorophenyl)-2-(hydroxymethyl)-4-[3-(trifluoromethyl)phenyl]butanoic acid (PubChem CID 57077928) has the molecular formula C18H17ClF3NO3 and a molecular weight of 387.79 g/mol. Its IUPAC name is 2-amino-3-(2-chlorophenyl)-2-(hydroxymethyl)-4-[3-(trifluoromethyl)phenyl]butanoic acid.
| Compound Name | 2-amino-3-(2-chlorophenyl)-2-(hydroxymethyl)-4-[3-(trifluoromethyl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 57077928 |
| Molecular Formula | C18H17ClF3NO3 |
| Molecular Weight | 387.79 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 2-amino-3-(2-chlorophenyl)-2-(hydroxymethyl)-4-[3-(trifluoromethyl)phenyl]butanoic acid |
| SMILES | NC(CO)(C(=O)O)C(Cc1cccc(C(F)(F)F)c1)c1ccccc1Cl |
| InChI | InChI=1S/C18H17ClF3NO3/c19-15-7-2-1-6-13(15)14(17(23,10-24)16(25)26)9-11-4-3-5-12(8-11)18(20,21)22/h1-8,14,24H,9-10,23H2,(H,25,26) |
| InChIKey | CGFUSWZADKPLMG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.79 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |