C24H27NO5 — CID 57078408
[1-[1,3-bis(4-methoxyphenyl)propan-2-yl]-3-ethenyl-4-oxoazetidin-2-yl] acetate (PubChem CID 57078408) has the molecular formula C24H27NO5 and a molecular weight of 409.48 g/mol. Its IUPAC name is [1-[1,3-bis(4-methoxyphenyl)propan-2-yl]-3-ethenyl-4-oxoazetidin-2-yl] acetate.
| Compound Name | [1-[1,3-bis(4-methoxyphenyl)propan-2-yl]-3-ethenyl-4-oxoazetidin-2-yl] acetate |
|---|---|
| PubChem CID | 57078408 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | [1-[1,3-bis(4-methoxyphenyl)propan-2-yl]-3-ethenyl-4-oxoazetidin-2-yl] acetate |
| SMILES | C=CC1C(=O)N(C(Cc2ccc(OC)cc2)Cc2ccc(OC)cc2)C1OC(C)=O |
| InChI | InChI=1S/C24H27NO5/c1-5-22-23(27)25(24(22)30-16(2)26)19(14-17-6-10-20(28-3)11-7-17)15-18-8-12-21(29-4)13-9-18/h5-13,19,22,24H,1,14-15H2,2-4H3 |
| InChIKey | CQJMMLAWVVLPON-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|