C20H26BrN3 — CID 57081420
4-bromo-3-(9H-carbazol-1-yl)-1-N,1-N,3-N,3-N-tetramethylbutane-1,3-diamine (PubChem CID 57081420) has the molecular formula C20H26BrN3 and a molecular weight of 388.35 g/mol. Its IUPAC name is 4-bromo-3-(9H-carbazol-1-yl)-1-N,1-N,3-N,3-N-tetramethylbutane-1,3-diamine.
| Compound Name | 4-bromo-3-(9H-carbazol-1-yl)-1-N,1-N,3-N,3-N-tetramethylbutane-1,3-diamine |
|---|---|
| PubChem CID | 57081420 |
| Molecular Formula | C20H26BrN3 |
| Molecular Weight | 388.35 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 4-bromo-3-(9H-carbazol-1-yl)-1-N,1-N,3-N,3-N-tetramethylbutane-1,3-diamine |
| SMILES | CN(C)CCC(CBr)(c1cccc2c1[nH]c1ccccc12)N(C)C |
| InChI | InChI=1S/C20H26BrN3/c1-23(2)13-12-20(14-21,24(3)4)17-10-7-9-16-15-8-5-6-11-18(15)22-19(16)17/h5-11,22H,12-14H2,1-4H3 |
| InChIKey | BCULWKXGMDQPHE-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 22.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.35 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|