C17H25N3O4 — CID 57085900
5-hydroxypentan-2-yl 2-(3-carbamoylphenyl)piperazine-1-carboxylate (PubChem CID 57085900) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is 5-hydroxypentan-2-yl 2-(3-carbamoylphenyl)piperazine-1-carboxylate.
| Compound Name | 5-hydroxypentan-2-yl 2-(3-carbamoylphenyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 57085900 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 5-hydroxypentan-2-yl 2-(3-carbamoylphenyl)piperazine-1-carboxylate |
| SMILES | CC(CCCO)OC(=O)N1CCNCC1c1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C17H25N3O4/c1-12(4-3-9-21)24-17(23)20-8-7-19-11-15(20)13-5-2-6-14(10-13)16(18)22/h2,5-6,10,12,15,19,21H,3-4,7-9,11H2,1H3,(H2,18,22) |
| InChIKey | VFKHAQGUTRUBTC-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |