C29H38N6O6 — CID 67599687
5-[2-(2-carbamoylphenyl)piperazine-1-carbonyl]oxypentyl 2-(3-carbamoylphenyl)piperazine-1-carboxylate (PubChem CID 67599687) has the molecular formula C29H38N6O6 and a molecular weight of 566.66 g/mol. Its IUPAC name is 5-[2-(2-carbamoylphenyl)piperazine-1-carbonyl]oxypentyl 2-(3-carbamoylphenyl)piperazine-1-carboxylate.
| Compound Name | 5-[2-(2-carbamoylphenyl)piperazine-1-carbonyl]oxypentyl 2-(3-carbamoylphenyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 67599687 |
| Molecular Formula | C29H38N6O6 |
| Molecular Weight | 566.66 g/mol |
| Exact Mass | 566.29 |
| IUPAC Name | 5-[2-(2-carbamoylphenyl)piperazine-1-carbonyl]oxypentyl 2-(3-carbamoylphenyl)piperazine-1-carboxylate |
| SMILES | NC(=O)c1cccc(C2CNCCN2C(=O)OCCCCCOC(=O)N2CCNCC2c2ccccc2C(N)=O)c1 |
| InChI | InChI=1S/C29H38N6O6/c30-26(36)21-8-6-7-20(17-21)24-18-32-11-13-34(24)28(38)40-15-4-1-5-16-41-29(39)35-14-12-33-19-25(35)22-9-2-3-10-23(22)27(31)37/h2-3,6-10,17,24-25,32-33H,1,4-5,11-16,18-19H2,(H2,30,36)(H2,31,37) |
| InChIKey | MIGAXFNDWSVPHT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 169.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.66 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|