C24H31N3O4 — CID 67600722
5-phenylmethoxypentyl 2-(3-carbamoylphenyl)piperazine-1-carboxylate (PubChem CID 67600722) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is 5-phenylmethoxypentyl 2-(3-carbamoylphenyl)piperazine-1-carboxylate.
| Compound Name | 5-phenylmethoxypentyl 2-(3-carbamoylphenyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 67600722 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | 5-phenylmethoxypentyl 2-(3-carbamoylphenyl)piperazine-1-carboxylate |
| SMILES | NC(=O)c1cccc(C2CNCCN2C(=O)OCCCCCOCc2ccccc2)c1 |
| InChI | InChI=1S/C24H31N3O4/c25-23(28)21-11-7-10-20(16-21)22-17-26-12-13-27(22)24(29)31-15-6-2-5-14-30-18-19-8-3-1-4-9-19/h1,3-4,7-11,16,22,26H,2,5-6,12-15,17-18H2,(H2,25,28) |
| InChIKey | ZYNGUWFTQCSOIO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|