C22H28N2O2S — CID 57086289
[(2S,3aS,7aS)-2-(1,3-thiazolidine-3-carbonyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-[(1S,2S)-2-phenylcyclopropyl]methanone (PubChem CID 57086289) has the molecular formula C22H28N2O2S and a molecular weight of 384.55 g/mol. Its IUPAC name is [(2S,3aS,7aS)-2-(1,3-thiazolidine-3-carbonyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-[(1S,2S)-2-phenylcyclopropyl]methanone.
| Compound Name | [(2S,3aS,7aS)-2-(1,3-thiazolidine-3-carbonyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-[(1S,2S)-2-phenylcyclopropyl]methanone |
|---|---|
| PubChem CID | 57086289 |
| Molecular Formula | C22H28N2O2S |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | [(2S,3aS,7aS)-2-(1,3-thiazolidine-3-carbonyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-[(1S,2S)-2-phenylcyclopropyl]methanone |
| SMILES | O=C([C@@H]1C[C@@H]2CCCC[C@@H]2N1C(=O)[C@H]1C[C@@H]1c1ccccc1)N1CCSC1 |
| InChI | InChI=1S/C22H28N2O2S/c25-21(18-13-17(18)15-6-2-1-3-7-15)24-19-9-5-4-8-16(19)12-20(24)22(26)23-10-11-27-14-23/h1-3,6-7,16-20H,4-5,8-14H2/t16-,17+,18-,19-,20-/m0/s1 |
| InChIKey | NXSXRIHXEQSYEZ-WPVAHCMFSA-N |
| XLogP | 3.48 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |