C14H21N5O — CID 57086536
1-carbamimidoyl-3-cyclobutyl-1-(3-pyridin-3-ylpropyl)urea (PubChem CID 57086536) has the molecular formula C14H21N5O and a molecular weight of 275.36 g/mol. Its IUPAC name is 1-carbamimidoyl-3-cyclobutyl-1-(3-pyridin-3-ylpropyl)urea.
| Compound Name | 1-carbamimidoyl-3-cyclobutyl-1-(3-pyridin-3-ylpropyl)urea |
|---|---|
| PubChem CID | 57086536 |
| Molecular Formula | C14H21N5O |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 1-carbamimidoyl-3-cyclobutyl-1-(3-pyridin-3-ylpropyl)urea |
| SMILES | [H]/N=C(\N)N(CCCc1cccnc1)C(=O)NC1CCC1 |
| InChI | InChI=1S/C14H21N5O/c15-13(16)19(14(20)18-12-6-1-7-12)9-3-5-11-4-2-8-17-10-11/h2,4,8,10,12H,1,3,5-7,9H2,(H3,15,16)(H,18,20) |
| InChIKey | FIQXFCVWVZSCSU-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 95.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|