C30H48N2O3P+ — CID 57089436
bis[(octylamino)-phenylmethoxy]-oxophosphanium (PubChem CID 57089436) has the molecular formula C30H48N2O3P+ and a molecular weight of 515.70 g/mol. Its IUPAC name is bis[(octylamino)-phenylmethoxy]-oxophosphanium.
| Compound Name | bis[(octylamino)-phenylmethoxy]-oxophosphanium |
|---|---|
| PubChem CID | 57089436 |
| Molecular Formula | C30H48N2O3P+ |
| Molecular Weight | 515.70 g/mol |
| Exact Mass | 515.34 |
| IUPAC Name | bis[(octylamino)-phenylmethoxy]-oxophosphanium |
| SMILES | CCCCCCCCNC(O[P+](=O)OC(NCCCCCCCC)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H48N2O3P/c1-3-5-7-9-11-19-25-31-29(27-21-15-13-16-22-27)34-36(33)35-30(28-23-17-14-18-24-28)32-26-20-12-10-8-6-4-2/h13-18,21-24,29-32H,3-12,19-20,25-26H2,1-2H3/q+1 |
| InChIKey | RAOPWVRREIGMRQ-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.70 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|