C26H38F2NO3P — CID 59691783
[(2,6-difluorophenyl)-hydroxymethyl]-[3-[(4-nonylphenyl)methylamino]propyl]phosphinic acid (PubChem CID 59691783) has the molecular formula C26H38F2NO3P and a molecular weight of 481.56 g/mol. Its IUPAC name is [(2,6-difluorophenyl)-hydroxymethyl]-[3-[(4-nonylphenyl)methylamino]propyl]phosphinic acid.
| Compound Name | [(2,6-difluorophenyl)-hydroxymethyl]-[3-[(4-nonylphenyl)methylamino]propyl]phosphinic acid |
|---|---|
| PubChem CID | 59691783 |
| Molecular Formula | C26H38F2NO3P |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | [(2,6-difluorophenyl)-hydroxymethyl]-[3-[(4-nonylphenyl)methylamino]propyl]phosphinic acid |
| SMILES | CCCCCCCCCc1ccc(CNCCCP(=O)(O)C(O)c2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C26H38F2NO3P/c1-2-3-4-5-6-7-8-11-21-14-16-22(17-15-21)20-29-18-10-19-33(31,32)26(30)25-23(27)12-9-13-24(25)28/h9,12-17,26,29-30H,2-8,10-11,18-20H2,1H3,(H,31,32) |
| InChIKey | FTZBCDVUNYZMOO-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|