C6H11NO2 — CID 57089664
N-[(1S,2S)-2-hydroxycyclopentyl]formamide (PubChem CID 57089664) has the molecular formula C6H11NO2 and a molecular weight of 129.16 g/mol. Its IUPAC name is N-[(1S,2S)-2-hydroxycyclopentyl]formamide.
| Compound Name | N-[(1S,2S)-2-hydroxycyclopentyl]formamide |
|---|---|
| PubChem CID | 57089664 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | N-[(1S,2S)-2-hydroxycyclopentyl]formamide |
| SMILES | O=CN[C@H]1CCC[C@@H]1O |
| InChI | InChI=1S/C6H11NO2/c8-4-7-5-2-1-3-6(5)9/h4-6,9H,1-3H2,(H,7,8)/t5-,6-/m0/s1 |
| InChIKey | GDMUFOFDWUXTMJ-WDSKDSINSA-N |
| XLogP | -0.35 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|