C19H28FNO — CID 57093584
(3aS,3bS,9aR,9bR,11aS)-6-(fluoromethyl)-9a,11a-dimethyl-1,2,3,3a,3b,4,6,8,9,9b,10,11-dodecahydrocyclopenta[i]phenanthridin-7-one (PubChem CID 57093584) has the molecular formula C19H28FNO and a molecular weight of 305.44 g/mol. Its IUPAC name is (3aS,3bS,9aR,9bR,11aS)-6-(fluoromethyl)-9a,11a-dimethyl-1,2,3,3a,3b,4,6,8,9,9b,10,11-dodecahydrocyclopenta[i]phenanthridin-7-one.
| Compound Name | (3aS,3bS,9aR,9bR,11aS)-6-(fluoromethyl)-9a,11a-dimethyl-1,2,3,3a,3b,4,6,8,9,9b,10,11-dodecahydrocyclopenta[i]phenanthridin-7-one |
|---|---|
| PubChem CID | 57093584 |
| Molecular Formula | C19H28FNO |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | (3aS,3bS,9aR,9bR,11aS)-6-(fluoromethyl)-9a,11a-dimethyl-1,2,3,3a,3b,4,6,8,9,9b,10,11-dodecahydrocyclopenta[i]phenanthridin-7-one |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CN=C3C(CF)C(=O)CC[C@]3(C)[C@@H]1CC2 |
| InChI | InChI=1S/C19H28FNO/c1-18-7-3-4-14(18)13-11-21-17-12(10-20)16(22)6-9-19(17,2)15(13)5-8-18/h12-15H,3-11H2,1-2H3/t12?,13-,14-,15+,18-,19+/m0/s1 |
| InChIKey | MAPIFAYGZRKXDR-KRZOTQTISA-N |
| XLogP | 4.23 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |