C13H14N2O3 — CID 57094997
3-morpholin-4-yl-2-(pyridin-2-ylmethyl)prop-1-ene-1,3-dione (PubChem CID 57094997) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is 3-morpholin-4-yl-2-(pyridin-2-ylmethyl)prop-1-ene-1,3-dione.
| Compound Name | 3-morpholin-4-yl-2-(pyridin-2-ylmethyl)prop-1-ene-1,3-dione |
|---|---|
| PubChem CID | 57094997 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 3-morpholin-4-yl-2-(pyridin-2-ylmethyl)prop-1-ene-1,3-dione |
| SMILES | O=C=C(Cc1ccccn1)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C13H14N2O3/c16-10-11(9-12-3-1-2-4-14-12)13(17)15-5-7-18-8-6-15/h1-4H,5-9H2 |
| InChIKey | APBIYXQFRFWURM-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|