C25H21ClF2O — CID 57096065
1-chloro-4-[(1R)-1-cyclopropyl-2-fluoro-4-[3-(4-fluorophenoxy)phenyl]but-2-enyl]benzene (PubChem CID 57096065) has the molecular formula C25H21ClF2O and a molecular weight of 410.89 g/mol. Its IUPAC name is 1-chloro-4-[(1R)-1-cyclopropyl-2-fluoro-4-[3-(4-fluorophenoxy)phenyl]but-2-enyl]benzene.
| Compound Name | 1-chloro-4-[(1R)-1-cyclopropyl-2-fluoro-4-[3-(4-fluorophenoxy)phenyl]but-2-enyl]benzene |
|---|---|
| PubChem CID | 57096065 |
| Molecular Formula | C25H21ClF2O |
| Molecular Weight | 410.89 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 1-chloro-4-[(1R)-1-cyclopropyl-2-fluoro-4-[3-(4-fluorophenoxy)phenyl]but-2-enyl]benzene |
| SMILES | FC(=CCc1cccc(Oc2ccc(F)cc2)c1)[C@@H](c1ccc(Cl)cc1)C1CC1 |
| InChI | InChI=1S/C25H21ClF2O/c26-20-9-7-19(8-10-20)25(18-5-6-18)24(28)15-4-17-2-1-3-23(16-17)29-22-13-11-21(27)12-14-22/h1-3,7-16,18,25H,4-6H2/t25-/m1/s1 |
| InChIKey | XQBORONAEOLVOI-RUZDIDTESA-N |
| XLogP | 7.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.89 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |