C17H19N3O3S — CID 57096120
1-(4-acetylpiperazin-1-yl)-2-[2-(1,3-thiazol-4-yl)phenoxy]ethanone (PubChem CID 57096120) has the molecular formula C17H19N3O3S and a molecular weight of 345.42 g/mol. Its IUPAC name is 1-(4-acetylpiperazin-1-yl)-2-[2-(1,3-thiazol-4-yl)phenoxy]ethanone.
| Compound Name | 1-(4-acetylpiperazin-1-yl)-2-[2-(1,3-thiazol-4-yl)phenoxy]ethanone |
|---|---|
| PubChem CID | 57096120 |
| Molecular Formula | C17H19N3O3S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 1-(4-acetylpiperazin-1-yl)-2-[2-(1,3-thiazol-4-yl)phenoxy]ethanone |
| SMILES | CC(=O)N1CCN(C(=O)COc2ccccc2-c2cscn2)CC1 |
| InChI | InChI=1S/C17H19N3O3S/c1-13(21)19-6-8-20(9-7-19)17(22)10-23-16-5-3-2-4-14(16)15-11-24-12-18-15/h2-5,11-12H,6-10H2,1H3 |
| InChIKey | ZNRWBBKGBVKILF-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |