C12H22O2 — CID 57097795
1-(3,3-dimethylbut-1-enoxy)-2,3-dimethylbut-3-en-1-ol (PubChem CID 57097795) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is 1-(3,3-dimethylbut-1-enoxy)-2,3-dimethylbut-3-en-1-ol.
| Compound Name | 1-(3,3-dimethylbut-1-enoxy)-2,3-dimethylbut-3-en-1-ol |
|---|---|
| PubChem CID | 57097795 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 1-(3,3-dimethylbut-1-enoxy)-2,3-dimethylbut-3-en-1-ol |
| SMILES | C=C(C)C(C)C(O)OC=CC(C)(C)C |
| InChI | InChI=1S/C12H22O2/c1-9(2)10(3)11(13)14-8-7-12(4,5)6/h7-8,10-11,13H,1H2,2-6H3 |
| InChIKey | GZFIMLGXRIRGIT-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|