About 4-sulfanyldecanoic acid
4-sulfanyldecanoic acid (PubChem CID 57100118) has the molecular formula C10H20O2S
and a molecular weight of 204.33 g/mol. Its IUPAC name is 4-sulfanyldecanoic acid.
Molecular Properties
| Compound Name | 4-sulfanyldecanoic acid |
| PubChem CID | 57100118 |
| Molecular Formula | C10H20O2S |
| Molecular Weight | 204.33 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 4-sulfanyldecanoic acid |
| SMILES | CCCCCCC(S)CCC(=O)O |
| InChI | InChI=1S/C10H20O2S/c1-2-3-4-5-6-9(13)7-8-10(11)12/h9,13H,2-8H2,1H3,(H,11,12) |
| InChIKey | ZFQDBTKTBBAZQE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.33 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-sulfanyldecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-sulfanyldecanoic acid?
The IUPAC name of 4-sulfanyldecanoic acid (CID 57100118) is 4-sulfanyldecanoic acid.
What is the SMILES notation for 4-sulfanyldecanoic acid?
The canonical SMILES for 4-sulfanyldecanoic acid is CCCCCCC(S)CCC(=O)O.
What is the InChIKey of 4-sulfanyldecanoic acid?
The InChIKey is ZFQDBTKTBBAZQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O2S/c1-2-3-4-5-6-9(13)7-8-10(11)12/h9,13H,2-8H2,1H3,(H,11,12).
What are the key properties of 4-sulfanyldecanoic acid?
4-sulfanyldecanoic acid has a molecular weight of 204.33 g/mol, XLogP of 3.12, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-sulfanyldecanoic acid is sourced from PubChem (CID 57100118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).