C10H11NO2 — CID 57102593
(1-amino-2,3-dihydroinden-1-yl) formate (PubChem CID 57102593) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is (1-amino-2,3-dihydroinden-1-yl) formate.
| Compound Name | (1-amino-2,3-dihydroinden-1-yl) formate |
|---|---|
| PubChem CID | 57102593 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | (1-amino-2,3-dihydroinden-1-yl) formate |
| SMILES | NC1(OC=O)CCc2ccccc21 |
| InChI | InChI=1S/C10H11NO2/c11-10(13-7-12)6-5-8-3-1-2-4-9(8)10/h1-4,7H,5-6,11H2 |
| InChIKey | JBZSPGUNXLIBCK-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|