C12H21NO4 — CID 57104955
[(3S)-2-hydroxy-1-oxo-1-(propylamino)hexan-3-yl] prop-2-enoate (PubChem CID 57104955) has the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. Its IUPAC name is [(3S)-2-hydroxy-1-oxo-1-(propylamino)hexan-3-yl] prop-2-enoate.
| Compound Name | [(3S)-2-hydroxy-1-oxo-1-(propylamino)hexan-3-yl] prop-2-enoate |
|---|---|
| PubChem CID | 57104955 |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | [(3S)-2-hydroxy-1-oxo-1-(propylamino)hexan-3-yl] prop-2-enoate |
| SMILES | C=CC(=O)O[C@@H](CCC)C(O)C(=O)NCCC |
| InChI | InChI=1S/C12H21NO4/c1-4-7-9(17-10(14)6-3)11(15)12(16)13-8-5-2/h6,9,11,15H,3-5,7-8H2,1-2H3,(H,13,16)/t9-,11?/m0/s1 |
| InChIKey | AOWCYUCNNQESFM-FTNKSUMCSA-N |
| XLogP | 0.77 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|