C18H17NO3 — CID 571051
methyl 4-methyl-2,4-diphenyl-5H-1,3-oxazole-5-carboxylate (PubChem CID 571051) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is methyl 4-methyl-2,4-diphenyl-5H-1,3-oxazole-5-carboxylate.
| Compound Name | methyl 4-methyl-2,4-diphenyl-5H-1,3-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 571051 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | methyl 4-methyl-2,4-diphenyl-5H-1,3-oxazole-5-carboxylate |
| SMILES | COC(=O)C1OC(c2ccccc2)=NC1(C)c1ccccc1 |
| InChI | InChI=1S/C18H17NO3/c1-18(14-11-7-4-8-12-14)15(17(20)21-2)22-16(19-18)13-9-5-3-6-10-13/h3-12,15H,1-2H3 |
| InChIKey | SKFYGJSXMDALCN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |