C18H27NO — CID 57105368
2-(cyclohexylmethyl)-3,3-dimethyl-1-pyridin-2-ylbutan-1-one (PubChem CID 57105368) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is 2-(cyclohexylmethyl)-3,3-dimethyl-1-pyridin-2-ylbutan-1-one.
| Compound Name | 2-(cyclohexylmethyl)-3,3-dimethyl-1-pyridin-2-ylbutan-1-one |
|---|---|
| PubChem CID | 57105368 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | 2-(cyclohexylmethyl)-3,3-dimethyl-1-pyridin-2-ylbutan-1-one |
| SMILES | CC(C)(C)C(CC1CCCCC1)C(=O)c1ccccn1 |
| InChI | InChI=1S/C18H27NO/c1-18(2,3)15(13-14-9-5-4-6-10-14)17(20)16-11-7-8-12-19-16/h7-8,11-12,14-15H,4-6,9-10,13H2,1-3H3 |
| InChIKey | XLJOWIZPUHRZQC-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |