C13H20N3O2PS3 — CID 57106975
[[4-[ethoxy(propylsulfanyl)phosphinothioyl]oxyphenyl]methylideneamino]thiourea (PubChem CID 57106975) has the molecular formula C13H20N3O2PS3 and a molecular weight of 377.50 g/mol. Its IUPAC name is [[4-[ethoxy(propylsulfanyl)phosphinothioyl]oxyphenyl]methylideneamino]thiourea.
| Compound Name | [[4-[ethoxy(propylsulfanyl)phosphinothioyl]oxyphenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 57106975 |
| Molecular Formula | C13H20N3O2PS3 |
| Molecular Weight | 377.50 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | [[4-[ethoxy(propylsulfanyl)phosphinothioyl]oxyphenyl]methylideneamino]thiourea |
| SMILES | CCCSP(=S)(OCC)Oc1ccc(C=NNC(N)=S)cc1 |
| InChI | InChI=1S/C13H20N3O2PS3/c1-3-9-22-19(21,17-4-2)18-12-7-5-11(6-8-12)10-15-16-13(14)20/h5-8,10H,3-4,9H2,1-2H3,(H3,14,16,20) |
| InChIKey | XCRCLQIQPYGOQT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.50 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|