C30H37ClN4O3S — CID 57108241
(2S)-N-[(2S)-3-(4-chlorophenyl)-1-oxo-1-(quinolin-8-ylamino)propan-2-yl]-4-methyl-2-(6-sulfanylhexanoylamino)pentanamide (PubChem CID 57108241) has the molecular formula C30H37ClN4O3S and a molecular weight of 569.17 g/mol. Its IUPAC name is (2S)-N-[(2S)-3-(4-chlorophenyl)-1-oxo-1-(quinolin-8-ylamino)propan-2-yl]-4-methyl-2-(6-sulfanylhexanoylamino)pentanamide.
| Compound Name | (2S)-N-[(2S)-3-(4-chlorophenyl)-1-oxo-1-(quinolin-8-ylamino)propan-2-yl]-4-methyl-2-(6-sulfanylhexanoylamino)pentanamide |
|---|---|
| PubChem CID | 57108241 |
| Molecular Formula | C30H37ClN4O3S |
| Molecular Weight | 569.17 g/mol |
| Exact Mass | 568.23 |
| IUPAC Name | (2S)-N-[(2S)-3-(4-chlorophenyl)-1-oxo-1-(quinolin-8-ylamino)propan-2-yl]-4-methyl-2-(6-sulfanylhexanoylamino)pentanamide |
| SMILES | CC(C)C[C@H](NC(=O)CCCCCS)C(=O)N[C@@H](Cc1ccc(Cl)cc1)C(=O)Nc1cccc2cccnc12 |
| InChI | InChI=1S/C30H37ClN4O3S/c1-20(2)18-25(33-27(36)11-4-3-5-17-39)29(37)35-26(19-21-12-14-23(31)15-13-21)30(38)34-24-10-6-8-22-9-7-16-32-28(22)24/h6-10,12-16,20,25-26,39H,3-5,11,17-19H2,1-2H3,(H,33,36)(H,34,38)(H,35,37)/t25-,26-/m0/s1 |
| InChIKey | CJSHWXQJRVGDBR-UIOOFZCWSA-N |
| XLogP | 5.58 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.17 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|