C16H20O6 — CID 57109771
2-[4-(1,3-dioxopent-4-en-2-yloxy)cyclohexyl]oxy-3-oxopent-4-enal (PubChem CID 57109771) has the molecular formula C16H20O6 and a molecular weight of 308.33 g/mol. Its IUPAC name is 2-[4-(1,3-dioxopent-4-en-2-yloxy)cyclohexyl]oxy-3-oxopent-4-enal.
| Compound Name | 2-[4-(1,3-dioxopent-4-en-2-yloxy)cyclohexyl]oxy-3-oxopent-4-enal |
|---|---|
| PubChem CID | 57109771 |
| Molecular Formula | C16H20O6 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 2-[4-(1,3-dioxopent-4-en-2-yloxy)cyclohexyl]oxy-3-oxopent-4-enal |
| SMILES | C=CC(=O)C(C=O)OC1CCC(OC(C=O)C(=O)C=C)CC1 |
| InChI | InChI=1S/C16H20O6/c1-3-13(19)15(9-17)21-11-5-7-12(8-6-11)22-16(10-18)14(20)4-2/h3-4,9-12,15-16H,1-2,5-8H2 |
| InChIKey | FIBJAUCMMHUQKI-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|