C12H20N2 — CID 57112228
N-cyclohexyl-N-methyl-3,4-dihydropyridin-2-amine (PubChem CID 57112228) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is N-cyclohexyl-N-methyl-3,4-dihydropyridin-2-amine.
| Compound Name | N-cyclohexyl-N-methyl-3,4-dihydropyridin-2-amine |
|---|---|
| PubChem CID | 57112228 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | N-cyclohexyl-N-methyl-3,4-dihydropyridin-2-amine |
| SMILES | CN(C1=NC=CCC1)C1CCCCC1 |
| InChI | InChI=1S/C12H20N2/c1-14(11-7-3-2-4-8-11)12-9-5-6-10-13-12/h6,10-11H,2-5,7-9H2,1H3 |
| InChIKey | WRIGWHFPXCFQCZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |