C20H26ClF3O — CID 57113006
(8S,9S,10S,13S,14S)-9-chloro-17-(difluoromethyl)-17-fluoro-10,13-dimethyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 57113006) has the molecular formula C20H26ClF3O and a molecular weight of 374.87 g/mol. Its IUPAC name is (8S,9S,10S,13S,14S)-9-chloro-17-(difluoromethyl)-17-fluoro-10,13-dimethyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10S,13S,14S)-9-chloro-17-(difluoromethyl)-17-fluoro-10,13-dimethyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 57113006 |
| Molecular Formula | C20H26ClF3O |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | (8S,9S,10S,13S,14S)-9-chloro-17-(difluoromethyl)-17-fluoro-10,13-dimethyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CC[C@]3(Cl)[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CCC2(F)C(F)F |
| InChI | InChI=1S/C20H26ClF3O/c1-17-7-5-13(25)11-12(17)3-4-15-14-6-8-20(24,16(22)23)18(14,2)9-10-19(15,17)21/h11,14-16H,3-10H2,1-2H3/t14-,15-,17-,18-,19-,20?/m0/s1 |
| InChIKey | BCIIYAZEWANBGP-GHHZOLNYSA-N |
| XLogP | 5.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|