C15H17NO4 — CID 57117046
tert-butyl 3-(4-formylphenyl)-2,5-dihydro-1,2-oxazole-5-carboxylate (PubChem CID 57117046) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is tert-butyl 3-(4-formylphenyl)-2,5-dihydro-1,2-oxazole-5-carboxylate.
| Compound Name | tert-butyl 3-(4-formylphenyl)-2,5-dihydro-1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 57117046 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | tert-butyl 3-(4-formylphenyl)-2,5-dihydro-1,2-oxazole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1C=C(c2ccc(C=O)cc2)NO1 |
| InChI | InChI=1S/C15H17NO4/c1-15(2,3)19-14(18)13-8-12(16-20-13)11-6-4-10(9-17)5-7-11/h4-9,13,16H,1-3H3 |
| InChIKey | FQLFHWQUEKXWAW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|