C14H17NO3 — CID 91248647
ethyl 5-ethyl-3-phenyl-2H-1,2-oxazole-5-carboxylate (PubChem CID 91248647) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is ethyl 5-ethyl-3-phenyl-2H-1,2-oxazole-5-carboxylate.
| Compound Name | ethyl 5-ethyl-3-phenyl-2H-1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 91248647 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | ethyl 5-ethyl-3-phenyl-2H-1,2-oxazole-5-carboxylate |
| SMILES | CCOC(=O)C1(CC)C=C(c2ccccc2)NO1 |
| InChI | InChI=1S/C14H17NO3/c1-3-14(13(16)17-4-2)10-12(15-18-14)11-8-6-5-7-9-11/h5-10,15H,3-4H2,1-2H3 |
| InChIKey | SMEKELDWLFSVIR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |