C11H11NO3 — CID 91319811
methyl 3-phenyl-2,5-dihydro-1,2-oxazole-5-carboxylate (PubChem CID 91319811) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is methyl 3-phenyl-2,5-dihydro-1,2-oxazole-5-carboxylate.
| Compound Name | methyl 3-phenyl-2,5-dihydro-1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 91319811 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | methyl 3-phenyl-2,5-dihydro-1,2-oxazole-5-carboxylate |
| SMILES | COC(=O)C1C=C(c2ccccc2)NO1 |
| InChI | InChI=1S/C11H11NO3/c1-14-11(13)10-7-9(12-15-10)8-5-3-2-4-6-8/h2-7,10,12H,1H3 |
| InChIKey | QCPASPWTOYOWNP-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |